C24H38IN5O3 — CID 109430742
tert-butyl N-[2-[[N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N'-methylcarbamimidoyl]amino]-1-(4-propan-2-ylphenyl)ethyl]carbamate;hydroiodide (PubChem CID 109430742) has the molecular formula C24H38IN5O3 and a molecular weight of 571.50 g/mol. Its IUPAC name is tert-butyl N-[2-[[N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N'-methylcarbamimidoyl]amino]-1-(4-propan-2-ylphenyl)ethyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[2-[[N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N'-methylcarbamimidoyl]amino]-1-(4-propan-2-ylphenyl)ethyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 109430742 |
| Molecular Formula | C24H38IN5O3 |
| Molecular Weight | 571.50 g/mol |
| Exact Mass | 571.20 |
| IUPAC Name | tert-butyl N-[2-[[N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-N'-methylcarbamimidoyl]amino]-1-(4-propan-2-ylphenyl)ethyl]carbamate;hydroiodide |
| SMILES | C/N=C(\NCc1nc(C)c(C)o1)NCC(NC(=O)OC(C)(C)C)c1ccc(C(C)C)cc1.I |
| InChI | InChI=1S/C24H37N5O3.HI/c1-15(2)18-9-11-19(12-10-18)20(29-23(30)32-24(5,6)7)13-26-22(25-8)27-14-21-28-16(3)17(4)31-21;/h9-12,15,20H,13-14H2,1-8H3,(H,29,30)(H2,25,26,27);1H |
| InChIKey | OOMJWAAPPOEAAZ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.50 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|