C22H35N7O2 — CID 111706437
tert-butyl N-[2-[[N'-methyl-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]-1-(4-propan-2-ylphenyl)ethyl]carbamate (PubChem CID 111706437) has the molecular formula C22H35N7O2 and a molecular weight of 429.57 g/mol. Its IUPAC name is tert-butyl N-[2-[[N'-methyl-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]-1-(4-propan-2-ylphenyl)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[N'-methyl-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]-1-(4-propan-2-ylphenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 111706437 |
| Molecular Formula | C22H35N7O2 |
| Molecular Weight | 429.57 g/mol |
| Exact Mass | 429.29 |
| IUPAC Name | tert-butyl N-[2-[[N'-methyl-N-[(2-methyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]-1-(4-propan-2-ylphenyl)ethyl]carbamate |
| SMILES | C/N=C(\NCc1ncnn1C)NCC(NC(=O)OC(C)(C)C)c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C22H35N7O2/c1-15(2)16-8-10-17(11-9-16)18(28-21(30)31-22(3,4)5)12-24-20(23-6)25-13-19-26-14-27-29(19)7/h8-11,14-15,18H,12-13H2,1-7H3,(H,28,30)(H2,23,24,25) |
| InChIKey | NWWFUOGHPWSUKA-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 105.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.57 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|