C19H28F3N7 — CID 111706981
1-[2-(diethylamino)-2-[4-(trifluoromethyl)phenyl]ethyl]-2-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine (PubChem CID 111706981) has the molecular formula C19H28F3N7 and a molecular weight of 411.48 g/mol. Its IUPAC name is 1-[2-(diethylamino)-2-[4-(trifluoromethyl)phenyl]ethyl]-2-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine.
| Compound Name | 1-[2-(diethylamino)-2-[4-(trifluoromethyl)phenyl]ethyl]-2-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111706981 |
| Molecular Formula | C19H28F3N7 |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | 1-[2-(diethylamino)-2-[4-(trifluoromethyl)phenyl]ethyl]-2-methyl-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine |
| SMILES | CCN(CC)C(CN/C(=N/C)NCc1ncnn1C)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H28F3N7/c1-5-29(6-2)16(14-7-9-15(10-8-14)19(20,21)22)11-24-18(23-3)25-12-17-26-13-27-28(17)4/h7-10,13,16H,5-6,11-12H2,1-4H3,(H2,23,24,25) |
| InChIKey | FAQMRRQYGKACAX-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|