C20H29IN4O2 — CID 109430884
1-[(2-cyclopentyloxyphenyl)methyl]-3-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 109430884) has the molecular formula C20H29IN4O2 and a molecular weight of 484.38 g/mol. Its IUPAC name is 1-[(2-cyclopentyloxyphenyl)methyl]-3-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(2-cyclopentyloxyphenyl)methyl]-3-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109430884 |
| Molecular Formula | C20H29IN4O2 |
| Molecular Weight | 484.38 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | 1-[(2-cyclopentyloxyphenyl)methyl]-3-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCc1nc(C)c(C)o1)NCc1ccccc1OC1CCCC1.I |
| InChI | InChI=1S/C20H28N4O2.HI/c1-14-15(2)25-19(24-14)13-23-20(21-3)22-12-16-8-4-7-11-18(16)26-17-9-5-6-10-17;/h4,7-8,11,17H,5-6,9-10,12-13H2,1-3H3,(H2,21,22,23);1H |
| InChIKey | NSXCLYUUMNRCKB-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 71.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.38 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|