C22H27IN4O2 — CID 109428300
1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[[2-(3-methylphenoxy)phenyl]methyl]guanidine;hydroiodide (PubChem CID 109428300) has the molecular formula C22H27IN4O2 and a molecular weight of 506.39 g/mol. Its IUPAC name is 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[[2-(3-methylphenoxy)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[[2-(3-methylphenoxy)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109428300 |
| Molecular Formula | C22H27IN4O2 |
| Molecular Weight | 506.39 g/mol |
| Exact Mass | 506.12 |
| IUPAC Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[[2-(3-methylphenoxy)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1nc(C)c(C)o1)NCc1ccccc1Oc1cccc(C)c1.I |
| InChI | InChI=1S/C22H26N4O2.HI/c1-15-8-7-10-19(12-15)28-20-11-6-5-9-18(20)13-24-22(23-4)25-14-21-26-16(2)17(3)27-21;/h5-12H,13-14H2,1-4H3,(H2,23,24,25);1H |
| InChIKey | ARWKBOIYGLXMQY-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 71.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.39 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|