C17H31N5O2 — CID 109431515
2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[[1-(2-methoxyethyl)pyrrolidin-2-yl]methyl]guanidine (PubChem CID 109431515) has the molecular formula C17H31N5O2 and a molecular weight of 337.47 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[[1-(2-methoxyethyl)pyrrolidin-2-yl]methyl]guanidine.
| Compound Name | 2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[[1-(2-methoxyethyl)pyrrolidin-2-yl]methyl]guanidine |
|---|---|
| PubChem CID | 109431515 |
| Molecular Formula | C17H31N5O2 |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.25 |
| IUPAC Name | 2-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-1-ethyl-3-[[1-(2-methoxyethyl)pyrrolidin-2-yl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1nc(C)c(C)o1)NCC1CCCN1CCOC |
| InChI | InChI=1S/C17H31N5O2/c1-5-18-17(20-12-16-21-13(2)14(3)24-16)19-11-15-7-6-8-22(15)9-10-23-4/h15H,5-12H2,1-4H3,(H2,18,19,20) |
| InChIKey | LJFXURHBZXSITB-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 74.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|