C19H31FN4O — CID 111854400
1-ethyl-2-[(4-fluoro-3-methylphenyl)methyl]-3-[[1-(2-methoxyethyl)pyrrolidin-2-yl]methyl]guanidine (PubChem CID 111854400) has the molecular formula C19H31FN4O and a molecular weight of 350.48 g/mol. Its IUPAC name is 1-ethyl-2-[(4-fluoro-3-methylphenyl)methyl]-3-[[1-(2-methoxyethyl)pyrrolidin-2-yl]methyl]guanidine.
| Compound Name | 1-ethyl-2-[(4-fluoro-3-methylphenyl)methyl]-3-[[1-(2-methoxyethyl)pyrrolidin-2-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111854400 |
| Molecular Formula | C19H31FN4O |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.25 |
| IUPAC Name | 1-ethyl-2-[(4-fluoro-3-methylphenyl)methyl]-3-[[1-(2-methoxyethyl)pyrrolidin-2-yl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(F)c(C)c1)NCC1CCCN1CCOC |
| InChI | InChI=1S/C19H31FN4O/c1-4-21-19(22-13-16-7-8-18(20)15(2)12-16)23-14-17-6-5-9-24(17)10-11-25-3/h7-8,12,17H,4-6,9-11,13-14H2,1-3H3,(H2,21,22,23) |
| InChIKey | AISOMDKOGGBYOO-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|