C9H11ClO2 — CID 10943204
(2S,3R)-2-[(E)-but-1-enyl]-3-chloro-2,3-dihydropyran-6-one (PubChem CID 10943204) has the molecular formula C9H11ClO2 and a molecular weight of 186.64 g/mol. Its IUPAC name is (2S,3R)-2-[(E)-but-1-enyl]-3-chloro-2,3-dihydropyran-6-one.
| Compound Name | (2S,3R)-2-[(E)-but-1-enyl]-3-chloro-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 10943204 |
| Molecular Formula | C9H11ClO2 |
| Molecular Weight | 186.64 g/mol |
| Exact Mass | 186.04 |
| IUPAC Name | (2S,3R)-2-[(E)-but-1-enyl]-3-chloro-2,3-dihydropyran-6-one |
| SMILES | CC/C=C/[C@@H]1OC(=O)C=C[C@H]1Cl |
| InChI | InChI=1S/C9H11ClO2/c1-2-3-4-8-7(10)5-6-9(11)12-8/h3-8H,2H2,1H3/b4-3+/t7-,8+/m1/s1 |
| InChIKey | KPKKTAAEWKFUCJ-ZGNIKFQOSA-N |
| XLogP | 2.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.64 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|