C17H23IN6O — CID 109432154
1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[(5-methylimidazo[1,2-a]pyridin-2-yl)methyl]guanidine;hydroiodide (PubChem CID 109432154) has the molecular formula C17H23IN6O and a molecular weight of 454.32 g/mol. Its IUPAC name is 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[(5-methylimidazo[1,2-a]pyridin-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[(5-methylimidazo[1,2-a]pyridin-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109432154 |
| Molecular Formula | C17H23IN6O |
| Molecular Weight | 454.32 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | 1-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-2-methyl-3-[(5-methylimidazo[1,2-a]pyridin-2-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1cn2c(C)cccc2n1)NCc1nc(C)c(C)o1.I |
| InChI | InChI=1S/C17H22N6O.HI/c1-11-6-5-7-15-22-14(10-23(11)15)8-19-17(18-4)20-9-16-21-12(2)13(3)24-16;/h5-7,10H,8-9H2,1-4H3,(H2,18,19,20);1H |
| InChIKey | VHRXHAVHGQRVIZ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 79.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|