C23H38N4O2S — CID 109437947
N-[3-[[[ethylamino-[(3-ethylsulfinylcyclohexyl)amino]methylidene]amino]methyl]phenyl]-2-methylbutanamide (PubChem CID 109437947) has the molecular formula C23H38N4O2S and a molecular weight of 434.65 g/mol. Its IUPAC name is N-[3-[[[ethylamino-[(3-ethylsulfinylcyclohexyl)amino]methylidene]amino]methyl]phenyl]-2-methylbutanamide.
| Compound Name | N-[3-[[[ethylamino-[(3-ethylsulfinylcyclohexyl)amino]methylidene]amino]methyl]phenyl]-2-methylbutanamide |
|---|---|
| PubChem CID | 109437947 |
| Molecular Formula | C23H38N4O2S |
| Molecular Weight | 434.65 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | N-[3-[[[ethylamino-[(3-ethylsulfinylcyclohexyl)amino]methylidene]amino]methyl]phenyl]-2-methylbutanamide |
| SMILES | CCN/C(=N\Cc1cccc(NC(=O)C(C)CC)c1)NC1CCCC(S(=O)CC)C1 |
| InChI | InChI=1S/C23H38N4O2S/c1-5-17(4)22(28)26-19-11-8-10-18(14-19)16-25-23(24-6-2)27-20-12-9-13-21(15-20)30(29)7-3/h8,10-11,14,17,20-21H,5-7,9,12-13,15-16H2,1-4H3,(H,26,28)(H2,24,25,27) |
| InChIKey | QAEHNTOWHPHOTO-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.65 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|