C16H32N4O3S2 — CID 109441183
1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-3-(3-ethylsulfinylcyclohexyl)-2-methylguanidine (PubChem CID 109441183) has the molecular formula C16H32N4O3S2 and a molecular weight of 392.59 g/mol. Its IUPAC name is 1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-3-(3-ethylsulfinylcyclohexyl)-2-methylguanidine.
| Compound Name | 1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-3-(3-ethylsulfinylcyclohexyl)-2-methylguanidine |
|---|---|
| PubChem CID | 109441183 |
| Molecular Formula | C16H32N4O3S2 |
| Molecular Weight | 392.59 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | 1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-3-(3-ethylsulfinylcyclohexyl)-2-methylguanidine |
| SMILES | CCS(=O)C1CCCC(N/C(=N/C)NCCN2CCS(=O)(=O)CC2)C1 |
| InChI | InChI=1S/C16H32N4O3S2/c1-3-24(21)15-6-4-5-14(13-15)19-16(17-2)18-7-8-20-9-11-25(22,23)12-10-20/h14-15H,3-13H2,1-2H3,(H2,17,18,19) |
| InChIKey | QGRFACFLBSNIJW-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.59 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|