C18H33N3O2 — CID 109442809
N'-methyl-N-[3-(oxan-4-yloxy)propyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide (PubChem CID 109442809) has the molecular formula C18H33N3O2 and a molecular weight of 323.48 g/mol. Its IUPAC name is N'-methyl-N-[3-(oxan-4-yloxy)propyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide.
| Compound Name | N'-methyl-N-[3-(oxan-4-yloxy)propyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide |
|---|---|
| PubChem CID | 109442809 |
| Molecular Formula | C18H33N3O2 |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.26 |
| IUPAC Name | N'-methyl-N-[3-(oxan-4-yloxy)propyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide |
| SMILES | C/N=C(\NCCCOC1CCOCC1)N1CC2CCCCC2C1 |
| InChI | InChI=1S/C18H33N3O2/c1-19-18(21-13-15-5-2-3-6-16(15)14-21)20-9-4-10-23-17-7-11-22-12-8-17/h15-17H,2-14H2,1H3,(H,19,20) |
| InChIKey | QNPRXABYIVLVNR-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|