C12H28O2Si — CID 10944330
(3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methylpentan-1-ol (PubChem CID 10944330) has the molecular formula C12H28O2Si and a molecular weight of 232.44 g/mol. Its IUPAC name is (3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methylpentan-1-ol.
| Compound Name | (3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methylpentan-1-ol |
|---|---|
| PubChem CID | 10944330 |
| Molecular Formula | C12H28O2Si |
| Molecular Weight | 232.44 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | (3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methylpentan-1-ol |
| SMILES | C[C@@H](CCO)[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H28O2Si/c1-10(8-9-13)11(2)14-15(6,7)12(3,4)5/h10-11,13H,8-9H2,1-7H3/t10-,11+/m0/s1 |
| InChIKey | LCWJICTURMVATD-WDEREUQCSA-N |
| XLogP | 3.42 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|