C17H25F3N6 — CID 109443521
N'-methyl-N-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide (PubChem CID 109443521) has the molecular formula C17H25F3N6 and a molecular weight of 370.42 g/mol. Its IUPAC name is N'-methyl-N-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide.
| Compound Name | N'-methyl-N-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide |
|---|---|
| PubChem CID | 109443521 |
| Molecular Formula | C17H25F3N6 |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | N'-methyl-N-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide |
| SMILES | C/N=C(\NCCNc1nccc(C(F)(F)F)n1)N1CC2CCCCC2C1 |
| InChI | InChI=1S/C17H25F3N6/c1-21-16(26-10-12-4-2-3-5-13(12)11-26)24-9-8-23-15-22-7-6-14(25-15)17(18,19)20/h6-7,12-13H,2-5,8-11H2,1H3,(H,21,24)(H,22,23,25) |
| InChIKey | XUJQQUMXEYUUOY-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 65.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|