C21H29IN4O — CID 109443816
N'-methyl-N-[[5-(4-methylphenyl)-1,3-oxazol-2-yl]methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide;hydroiodide (PubChem CID 109443816) has the molecular formula C21H29IN4O and a molecular weight of 480.39 g/mol. Its IUPAC name is N'-methyl-N-[[5-(4-methylphenyl)-1,3-oxazol-2-yl]methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide;hydroiodide.
| Compound Name | N'-methyl-N-[[5-(4-methylphenyl)-1,3-oxazol-2-yl]methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109443816 |
| Molecular Formula | C21H29IN4O |
| Molecular Weight | 480.39 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | N'-methyl-N-[[5-(4-methylphenyl)-1,3-oxazol-2-yl]methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1ncc(-c2ccc(C)cc2)o1)N1CC2CCCCC2C1.I |
| InChI | InChI=1S/C21H28N4O.HI/c1-15-7-9-16(10-8-15)19-11-23-20(26-19)12-24-21(22-2)25-13-17-5-3-4-6-18(17)14-25;/h7-11,17-18H,3-6,12-14H2,1-2H3,(H,22,24);1H |
| InChIKey | HHHVTPQYLGFSRC-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 53.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.39 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|