C18H27F3N6 — CID 109444293
N-ethyl-N'-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide (PubChem CID 109444293) has the molecular formula C18H27F3N6 and a molecular weight of 384.45 g/mol. Its IUPAC name is N-ethyl-N'-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide.
| Compound Name | N-ethyl-N'-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide |
|---|---|
| PubChem CID | 109444293 |
| Molecular Formula | C18H27F3N6 |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | N-ethyl-N'-[2-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]ethyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide |
| SMILES | CCN/C(=N\CCNc1nccc(C(F)(F)F)n1)N1CC2CCCCC2C1 |
| InChI | InChI=1S/C18H27F3N6/c1-2-22-17(27-11-13-5-3-4-6-14(13)12-27)25-10-9-24-16-23-8-7-15(26-16)18(19,20)21/h7-8,13-14H,2-6,9-12H2,1H3,(H,22,25)(H,23,24,26) |
| InChIKey | YOKVTFFIZGLVAZ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 65.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|