C22H26FIN4O2S — CID 109444634
1-ethyl-2-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-3-(quinolin-8-ylmethyl)guanidine;hydroiodide (PubChem CID 109444634) has the molecular formula C22H26FIN4O2S and a molecular weight of 556.45 g/mol. Its IUPAC name is 1-ethyl-2-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-3-(quinolin-8-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-3-(quinolin-8-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109444634 |
| Molecular Formula | C22H26FIN4O2S |
| Molecular Weight | 556.45 g/mol |
| Exact Mass | 556.08 |
| IUPAC Name | 1-ethyl-2-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-3-(quinolin-8-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(F)ccc1CS(C)(=O)=O)NCc1cccc2cccnc12.I |
| InChI | InChI=1S/C22H25FN4O2S.HI/c1-3-24-22(26-13-17-7-4-6-16-8-5-11-25-21(16)17)27-14-19-12-20(23)10-9-18(19)15-30(2,28)29;/h4-12H,3,13-15H2,1-2H3,(H2,24,26,27);1H |
| InChIKey | LAQYVMUWDLXCIP-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.45 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|