C23H31FN4O2S — CID 109445603
1-ethyl-3-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]guanidine (PubChem CID 109445603) has the molecular formula C23H31FN4O2S and a molecular weight of 446.59 g/mol. Its IUPAC name is 1-ethyl-3-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]guanidine |
|---|---|
| PubChem CID | 109445603 |
| Molecular Formula | C23H31FN4O2S |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | 1-ethyl-3-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-2-[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc2c(c1)CCCN2C)NCc1cc(F)ccc1CS(C)(=O)=O |
| InChI | InChI=1S/C23H31FN4O2S/c1-4-25-23(26-14-17-7-10-22-18(12-17)6-5-11-28(22)2)27-15-20-13-21(24)9-8-19(20)16-31(3,29)30/h7-10,12-13H,4-6,11,14-16H2,1-3H3,(H2,25,26,27) |
| InChIKey | FQMRFPQAPUBNCX-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|