C23H32FN3O3S — CID 109445859
1-ethyl-2-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-3-(4-phenylmethoxybutyl)guanidine (PubChem CID 109445859) has the molecular formula C23H32FN3O3S and a molecular weight of 449.59 g/mol. Its IUPAC name is 1-ethyl-2-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-3-(4-phenylmethoxybutyl)guanidine.
| Compound Name | 1-ethyl-2-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-3-(4-phenylmethoxybutyl)guanidine |
|---|---|
| PubChem CID | 109445859 |
| Molecular Formula | C23H32FN3O3S |
| Molecular Weight | 449.59 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | 1-ethyl-2-[[5-fluoro-2-(methylsulfonylmethyl)phenyl]methyl]-3-(4-phenylmethoxybutyl)guanidine |
| SMILES | CCN/C(=N\Cc1cc(F)ccc1CS(C)(=O)=O)NCCCCOCc1ccccc1 |
| InChI | InChI=1S/C23H32FN3O3S/c1-3-25-23(26-13-7-8-14-30-17-19-9-5-4-6-10-19)27-16-21-15-22(24)12-11-20(21)18-31(2,28)29/h4-6,9-12,15H,3,7-8,13-14,16-18H2,1-2H3,(H2,25,26,27) |
| InChIKey | SAMYCYUWVPIWHJ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.59 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|