C23H38IN3O3 — CID 109447088
N-ethyl-N'-[2-(3-methylphenoxy)ethyl]-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide (PubChem CID 109447088) has the molecular formula C23H38IN3O3 and a molecular weight of 531.48 g/mol. Its IUPAC name is N-ethyl-N'-[2-(3-methylphenoxy)ethyl]-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[2-(3-methylphenoxy)ethyl]-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109447088 |
| Molecular Formula | C23H38IN3O3 |
| Molecular Weight | 531.48 g/mol |
| Exact Mass | 531.20 |
| IUPAC Name | N-ethyl-N'-[2-(3-methylphenoxy)ethyl]-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCOc1cccc(C)c1)N1CCC(OCC2CCCCO2)CC1.I |
| InChI | InChI=1S/C23H37N3O3.HI/c1-3-24-23(25-12-16-28-21-9-6-7-19(2)17-21)26-13-10-20(11-14-26)29-18-22-8-4-5-15-27-22;/h6-7,9,17,20,22H,3-5,8,10-16,18H2,1-2H3,(H,24,25);1H |
| InChIKey | LSFHUEOZLJWWEI-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 55.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.48 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|