C18H31F3N4O3 — CID 109447263
N-methyl-2-[[N-methyl-C-[4-(oxan-2-ylmethoxy)piperidin-1-yl]carbonimidoyl]amino]-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 109447263) has the molecular formula C18H31F3N4O3 and a molecular weight of 408.47 g/mol. Its IUPAC name is N-methyl-2-[[N-methyl-C-[4-(oxan-2-ylmethoxy)piperidin-1-yl]carbonimidoyl]amino]-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | N-methyl-2-[[N-methyl-C-[4-(oxan-2-ylmethoxy)piperidin-1-yl]carbonimidoyl]amino]-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 109447263 |
| Molecular Formula | C18H31F3N4O3 |
| Molecular Weight | 408.47 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | N-methyl-2-[[N-methyl-C-[4-(oxan-2-ylmethoxy)piperidin-1-yl]carbonimidoyl]amino]-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | C/N=C(\NCC(=O)N(C)CC(F)(F)F)N1CCC(OCC2CCCCO2)CC1 |
| InChI | InChI=1S/C18H31F3N4O3/c1-22-17(23-11-16(26)24(2)13-18(19,20)21)25-8-6-14(7-9-25)28-12-15-5-3-4-10-27-15/h14-15H,3-13H2,1-2H3,(H,22,23) |
| InChIKey | BMUXQMSCNYSWEM-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.47 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|