About 1-[2-(cyclohexen-1-yl)ethyl]pyrrolidine;trifluoroborane
1-[2-(cyclohexen-1-yl)ethyl]pyrrolidine;trifluoroborane (PubChem CID 10944742) has the molecular formula C12H21BF3N
and a molecular weight of 247.11 g/mol. Its IUPAC name is 1-[2-(cyclohexen-1-yl)ethyl]pyrrolidine;trifluoroborane.
Molecular Properties
| Compound Name | 1-[2-(cyclohexen-1-yl)ethyl]pyrrolidine;trifluoroborane |
| PubChem CID | 10944742 |
| Molecular Formula | C12H21BF3N |
| Molecular Weight | 247.11 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | 1-[2-(cyclohexen-1-yl)ethyl]pyrrolidine;trifluoroborane |
| SMILES | C1=C(CCN2CCCC2)CCCC1.FB(F)F |
| InChI | InChI=1S/C12H21N.BF3/c1-2-6-12(7-3-1)8-11-13-9-4-5-10-13;2-1(3)4/h6H,1-5,7-11H2; |
| InChIKey | DURDZXNENOZVEU-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.11 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(cyclohexen-1-yl)ethyl]pyrrolidine;trifluoroborane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(cyclohexen-1-yl)ethyl]pyrrolidine;trifluoroborane?
The IUPAC name of 1-[2-(cyclohexen-1-yl)ethyl]pyrrolidine;trifluoroborane (CID 10944742) is 1-[2-(cyclohexen-1-yl)ethyl]pyrrolidine;trifluoroborane.
What is the SMILES notation for 1-[2-(cyclohexen-1-yl)ethyl]pyrrolidine;trifluoroborane?
The canonical SMILES for 1-[2-(cyclohexen-1-yl)ethyl]pyrrolidine;trifluoroborane is C1=C(CCN2CCCC2)CCCC1.FB(F)F.
What is the InChIKey of 1-[2-(cyclohexen-1-yl)ethyl]pyrrolidine;trifluoroborane?
The InChIKey is DURDZXNENOZVEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N.BF3/c1-2-6-12(7-3-1)8-11-13-9-4-5-10-13;2-1(3)4/h6H,1-5,7-11H2;.
What are the key properties of 1-[2-(cyclohexen-1-yl)ethyl]pyrrolidine;trifluoroborane?
1-[2-(cyclohexen-1-yl)ethyl]pyrrolidine;trifluoroborane has a molecular weight of 247.11 g/mol, XLogP of 3.85, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(cyclohexen-1-yl)ethyl]pyrrolidine;trifluoroborane is sourced from PubChem (CID 10944742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).