C19H24F2N2O — CID 113073154
[4-[2-(cyclohexen-1-yl)ethyl]piperazin-1-yl]-(3,4-difluorophenyl)methanone (PubChem CID 113073154) has the molecular formula C19H24F2N2O and a molecular weight of 334.41 g/mol. Its IUPAC name is [4-[2-(cyclohexen-1-yl)ethyl]piperazin-1-yl]-(3,4-difluorophenyl)methanone.
| Compound Name | [4-[2-(cyclohexen-1-yl)ethyl]piperazin-1-yl]-(3,4-difluorophenyl)methanone |
|---|---|
| PubChem CID | 113073154 |
| Molecular Formula | C19H24F2N2O |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | [4-[2-(cyclohexen-1-yl)ethyl]piperazin-1-yl]-(3,4-difluorophenyl)methanone |
| SMILES | O=C(c1ccc(F)c(F)c1)N1CCN(CCC2=CCCCC2)CC1 |
| InChI | InChI=1S/C19H24F2N2O/c20-17-7-6-16(14-18(17)21)19(24)23-12-10-22(11-13-23)9-8-15-4-2-1-3-5-15/h4,6-7,14H,1-3,5,8-13H2 |
| InChIKey | VSDMBPBXCIAOSU-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|