C18H24F2N4O2 — CID 120981002
3-[4-(3,4-difluorobenzoyl)piperazin-1-yl]-1-piperazin-1-ylpropan-1-one (PubChem CID 120981002) has the molecular formula C18H24F2N4O2 and a molecular weight of 366.41 g/mol. Its IUPAC name is 3-[4-(3,4-difluorobenzoyl)piperazin-1-yl]-1-piperazin-1-ylpropan-1-one.
| Compound Name | 3-[4-(3,4-difluorobenzoyl)piperazin-1-yl]-1-piperazin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 120981002 |
| Molecular Formula | C18H24F2N4O2 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 3-[4-(3,4-difluorobenzoyl)piperazin-1-yl]-1-piperazin-1-ylpropan-1-one |
| SMILES | O=C(CCN1CCN(C(=O)c2ccc(F)c(F)c2)CC1)N1CCNCC1 |
| InChI | InChI=1S/C18H24F2N4O2/c19-15-2-1-14(13-16(15)20)18(26)24-11-9-22(10-12-24)6-3-17(25)23-7-4-21-5-8-23/h1-2,13,21H,3-12H2 |
| InChIKey | SRAQVNRHPFWHCV-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |