C13H13F2N3O — CID 28705338
2-[4-(3,4-difluorobenzoyl)piperazin-1-yl]acetonitrile (PubChem CID 28705338) has the molecular formula C13H13F2N3O and a molecular weight of 265.26 g/mol. Its IUPAC name is 2-[4-(3,4-difluorobenzoyl)piperazin-1-yl]acetonitrile.
| Compound Name | 2-[4-(3,4-difluorobenzoyl)piperazin-1-yl]acetonitrile |
|---|---|
| PubChem CID | 28705338 |
| Molecular Formula | C13H13F2N3O |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 2-[4-(3,4-difluorobenzoyl)piperazin-1-yl]acetonitrile |
| SMILES | N#CCN1CCN(C(=O)c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C13H13F2N3O/c14-11-2-1-10(9-12(11)15)13(19)18-7-5-17(4-3-16)6-8-18/h1-2,9H,4-8H2 |
| InChIKey | XIZYHGCPMSMBSY-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|