C14H16FN3O — CID 78860879
2-[4-(3-fluorobenzoyl)-1,4-diazepan-1-yl]acetonitrile (PubChem CID 78860879) has the molecular formula C14H16FN3O and a molecular weight of 261.30 g/mol. Its IUPAC name is 2-[4-(3-fluorobenzoyl)-1,4-diazepan-1-yl]acetonitrile.
| Compound Name | 2-[4-(3-fluorobenzoyl)-1,4-diazepan-1-yl]acetonitrile |
|---|---|
| PubChem CID | 78860879 |
| Molecular Formula | C14H16FN3O |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 2-[4-(3-fluorobenzoyl)-1,4-diazepan-1-yl]acetonitrile |
| SMILES | N#CCN1CCCN(C(=O)c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C14H16FN3O/c15-13-4-1-3-12(11-13)14(19)18-7-2-6-17(8-5-16)9-10-18/h1,3-4,11H,2,6-10H2 |
| InChIKey | AAUNMLUIHADJIE-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|