C16H24O2 — CID 10944794
(3S,4aR,5R)-3-methoxy-3,8-dimethyl-5-propan-2-yl-4,4a,5,6-tetrahydronaphthalen-2-one (PubChem CID 10944794) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is (3S,4aR,5R)-3-methoxy-3,8-dimethyl-5-propan-2-yl-4,4a,5,6-tetrahydronaphthalen-2-one.
| Compound Name | (3S,4aR,5R)-3-methoxy-3,8-dimethyl-5-propan-2-yl-4,4a,5,6-tetrahydronaphthalen-2-one |
|---|---|
| PubChem CID | 10944794 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | (3S,4aR,5R)-3-methoxy-3,8-dimethyl-5-propan-2-yl-4,4a,5,6-tetrahydronaphthalen-2-one |
| SMILES | CO[C@@]1(C)C[C@H]2C(=CC1=O)C(C)=CC[C@@H]2C(C)C |
| InChI | InChI=1S/C16H24O2/c1-10(2)12-7-6-11(3)13-8-15(17)16(4,18-5)9-14(12)13/h6,8,10,12,14H,7,9H2,1-5H3/t12-,14-,16+/m1/s1 |
| InChIKey | WNVGXIGDSODCRK-XPKDYRNWSA-N |
| XLogP | 3.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |