C14H18O — CID 125113933
(4aR,5S)-8-methyl-5-prop-1-en-2-yl-4,4a,5,6-tetrahydro-3H-naphthalen-2-one (PubChem CID 125113933) has the molecular formula C14H18O and a molecular weight of 202.30 g/mol. Its IUPAC name is (4aR,5S)-8-methyl-5-prop-1-en-2-yl-4,4a,5,6-tetrahydro-3H-naphthalen-2-one.
| Compound Name | (4aR,5S)-8-methyl-5-prop-1-en-2-yl-4,4a,5,6-tetrahydro-3H-naphthalen-2-one |
|---|---|
| PubChem CID | 125113933 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | (4aR,5S)-8-methyl-5-prop-1-en-2-yl-4,4a,5,6-tetrahydro-3H-naphthalen-2-one |
| SMILES | C=C(C)[C@H]1CC=C(C)C2=CC(=O)CC[C@@H]21 |
| InChI | InChI=1S/C14H18O/c1-9(2)12-6-4-10(3)14-8-11(15)5-7-13(12)14/h4,8,12-13H,1,5-7H2,2-3H3/t12-,13-/m1/s1 |
| InChIKey | SIKKHXYDIWGJAV-CHWSQXEVSA-N |
| XLogP | 3.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|