C17H24O2 — CID 10611389
(Z)-5-[(1R,6R)-1,3-dimethyl-2-oxo-6-prop-1-en-2-ylcyclohex-3-en-1-yl]-2-methylpent-2-enal (PubChem CID 10611389) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is (Z)-5-[(1R,6R)-1,3-dimethyl-2-oxo-6-prop-1-en-2-ylcyclohex-3-en-1-yl]-2-methylpent-2-enal.
| Compound Name | (Z)-5-[(1R,6R)-1,3-dimethyl-2-oxo-6-prop-1-en-2-ylcyclohex-3-en-1-yl]-2-methylpent-2-enal |
|---|---|
| PubChem CID | 10611389 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | (Z)-5-[(1R,6R)-1,3-dimethyl-2-oxo-6-prop-1-en-2-ylcyclohex-3-en-1-yl]-2-methylpent-2-enal |
| SMILES | C=C(C)[C@H]1CC=C(C)C(=O)[C@]1(C)CC/C=C(/C)C=O |
| InChI | InChI=1S/C17H24O2/c1-12(2)15-9-8-14(4)16(19)17(15,5)10-6-7-13(3)11-18/h7-8,11,15H,1,6,9-10H2,2-5H3/b13-7-/t15-,17-/m1/s1 |
| InChIKey | CRGMZOKBLZWVLU-SQNOUHKPSA-N |
| XLogP | 4.03 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|