C14H19IO — CID 22466510
6-[(E)-3-iodoprop-2-enyl]-2,6-dimethyl-5-prop-1-en-2-ylcyclohex-2-en-1-one (PubChem CID 22466510) has the molecular formula C14H19IO and a molecular weight of 330.21 g/mol. Its IUPAC name is 6-[(E)-3-iodoprop-2-enyl]-2,6-dimethyl-5-prop-1-en-2-ylcyclohex-2-en-1-one.
| Compound Name | 6-[(E)-3-iodoprop-2-enyl]-2,6-dimethyl-5-prop-1-en-2-ylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 22466510 |
| Molecular Formula | C14H19IO |
| Molecular Weight | 330.21 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 6-[(E)-3-iodoprop-2-enyl]-2,6-dimethyl-5-prop-1-en-2-ylcyclohex-2-en-1-one |
| SMILES | C=C(C)C1CC=C(C)C(=O)C1(C)C/C=C/I |
| InChI | InChI=1S/C14H19IO/c1-10(2)12-7-6-11(3)13(16)14(12,4)8-5-9-15/h5-6,9,12H,1,7-8H2,2-4H3/b9-5+ |
| InChIKey | VGPVPXHZSULHGQ-WEVVVXLNSA-N |
| XLogP | 4.44 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.21 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|