C25H42IN3O4 — CID 109450298
N-ethyl-N'-[3-[(4-methoxyphenyl)methoxy]propyl]-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide (PubChem CID 109450298) has the molecular formula C25H42IN3O4 and a molecular weight of 575.53 g/mol. Its IUPAC name is N-ethyl-N'-[3-[(4-methoxyphenyl)methoxy]propyl]-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[3-[(4-methoxyphenyl)methoxy]propyl]-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109450298 |
| Molecular Formula | C25H42IN3O4 |
| Molecular Weight | 575.53 g/mol |
| Exact Mass | 575.22 |
| IUPAC Name | N-ethyl-N'-[3-[(4-methoxyphenyl)methoxy]propyl]-4-(oxan-2-ylmethoxy)piperidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCCOCc1ccc(OC)cc1)N1CCC(OCC2CCCCO2)CC1.I |
| InChI | InChI=1S/C25H41N3O4.HI/c1-3-26-25(27-14-6-17-30-19-21-8-10-22(29-2)11-9-21)28-15-12-23(13-16-28)32-20-24-7-4-5-18-31-24;/h8-11,23-24H,3-7,12-20H2,1-2H3,(H,26,27);1H |
| InChIKey | NFSIWRYYEYILHL-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 64.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.53 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|