C17H32F3IN4O2S — CID 109452384
N-ethyl-2,2,3,3-tetramethyl-N'-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]azetidine-1-carboximidamide;hydroiodide (PubChem CID 109452384) has the molecular formula C17H32F3IN4O2S and a molecular weight of 540.43 g/mol. Its IUPAC name is N-ethyl-2,2,3,3-tetramethyl-N'-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]azetidine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-2,2,3,3-tetramethyl-N'-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]azetidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109452384 |
| Molecular Formula | C17H32F3IN4O2S |
| Molecular Weight | 540.43 g/mol |
| Exact Mass | 540.12 |
| IUPAC Name | N-ethyl-2,2,3,3-tetramethyl-N'-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]azetidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC1CCN(S(=O)(=O)C(F)(F)F)CC1)N1CC(C)(C)C1(C)C.I |
| InChI | InChI=1S/C17H31F3N4O2S.HI/c1-6-21-14(24-12-15(2,3)16(24,4)5)22-11-13-7-9-23(10-8-13)27(25,26)17(18,19)20;/h13H,6-12H2,1-5H3,(H,21,22);1H |
| InChIKey | NJWJHEHNXJTQSX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.43 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|