C19H35F3N4 — CID 109453434
N-ethyl-2,2,3,3-tetramethyl-N'-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]azetidine-1-carboximidamide (PubChem CID 109453434) has the molecular formula C19H35F3N4 and a molecular weight of 376.51 g/mol. Its IUPAC name is N-ethyl-2,2,3,3-tetramethyl-N'-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]azetidine-1-carboximidamide.
| Compound Name | N-ethyl-2,2,3,3-tetramethyl-N'-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]azetidine-1-carboximidamide |
|---|---|
| PubChem CID | 109453434 |
| Molecular Formula | C19H35F3N4 |
| Molecular Weight | 376.51 g/mol |
| Exact Mass | 376.28 |
| IUPAC Name | N-ethyl-2,2,3,3-tetramethyl-N'-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethyl]azetidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCC1CCN(CC(F)(F)F)CC1)N1CC(C)(C)C1(C)C |
| InChI | InChI=1S/C19H35F3N4/c1-6-23-16(26-13-17(2,3)18(26,4)5)24-10-7-15-8-11-25(12-9-15)14-19(20,21)22/h15H,6-14H2,1-5H3,(H,23,24) |
| InChIKey | DIHOXTFMRBYODO-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.51 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|