C14H26F3N3 — CID 109453552
N',2,2,3,3-pentamethyl-N-(5,5,5-trifluoropentyl)azetidine-1-carboximidamide (PubChem CID 109453552) has the molecular formula C14H26F3N3 and a molecular weight of 293.38 g/mol. Its IUPAC name is N',2,2,3,3-pentamethyl-N-(5,5,5-trifluoropentyl)azetidine-1-carboximidamide.
| Compound Name | N',2,2,3,3-pentamethyl-N-(5,5,5-trifluoropentyl)azetidine-1-carboximidamide |
|---|---|
| PubChem CID | 109453552 |
| Molecular Formula | C14H26F3N3 |
| Molecular Weight | 293.38 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | N',2,2,3,3-pentamethyl-N-(5,5,5-trifluoropentyl)azetidine-1-carboximidamide |
| SMILES | C/N=C(\NCCCCC(F)(F)F)N1CC(C)(C)C1(C)C |
| InChI | InChI=1S/C14H26F3N3/c1-12(2)10-20(13(12,3)4)11(18-5)19-9-7-6-8-14(15,16)17/h6-10H2,1-5H3,(H,18,19) |
| InChIKey | BLICFJFLTICQME-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|