C15H29F3N4 — CID 109452761
N-ethyl-2,2,3,3-tetramethyl-N'-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]azetidine-1-carboximidamide (PubChem CID 109452761) has the molecular formula C15H29F3N4 and a molecular weight of 322.42 g/mol. Its IUPAC name is N-ethyl-2,2,3,3-tetramethyl-N'-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]azetidine-1-carboximidamide.
| Compound Name | N-ethyl-2,2,3,3-tetramethyl-N'-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]azetidine-1-carboximidamide |
|---|---|
| PubChem CID | 109452761 |
| Molecular Formula | C15H29F3N4 |
| Molecular Weight | 322.42 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | N-ethyl-2,2,3,3-tetramethyl-N'-[2-[methyl(2,2,2-trifluoroethyl)amino]ethyl]azetidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCN(C)CC(F)(F)F)N1CC(C)(C)C1(C)C |
| InChI | InChI=1S/C15H29F3N4/c1-7-19-12(22-10-13(2,3)14(22,4)5)20-8-9-21(6)11-15(16,17)18/h7-11H2,1-6H3,(H,19,20) |
| InChIKey | YOTNFCGNPRMSJS-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.42 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|