C17H33N3OS — CID 109452923
N-[(4-ethylsulfanyloxan-4-yl)methyl]-N',2,2,3,3-pentamethylazetidine-1-carboximidamide (PubChem CID 109452923) has the molecular formula C17H33N3OS and a molecular weight of 327.54 g/mol. Its IUPAC name is N-[(4-ethylsulfanyloxan-4-yl)methyl]-N',2,2,3,3-pentamethylazetidine-1-carboximidamide.
| Compound Name | N-[(4-ethylsulfanyloxan-4-yl)methyl]-N',2,2,3,3-pentamethylazetidine-1-carboximidamide |
|---|---|
| PubChem CID | 109452923 |
| Molecular Formula | C17H33N3OS |
| Molecular Weight | 327.54 g/mol |
| Exact Mass | 327.23 |
| IUPAC Name | N-[(4-ethylsulfanyloxan-4-yl)methyl]-N',2,2,3,3-pentamethylazetidine-1-carboximidamide |
| SMILES | CCSC1(CN/C(=N\C)N2CC(C)(C)C2(C)C)CCOCC1 |
| InChI | InChI=1S/C17H33N3OS/c1-7-22-17(8-10-21-11-9-17)12-19-14(18-6)20-13-15(2,3)16(20,4)5/h7-13H2,1-6H3,(H,18,19) |
| InChIKey | OGRRTWNNQOZREP-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.54 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|