C24H38N4O3 — CID 109452939
N-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-N',2,2,3,3-pentamethylazetidine-1-carboximidamide (PubChem CID 109452939) has the molecular formula C24H38N4O3 and a molecular weight of 430.59 g/mol. Its IUPAC name is N-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-N',2,2,3,3-pentamethylazetidine-1-carboximidamide.
| Compound Name | N-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-N',2,2,3,3-pentamethylazetidine-1-carboximidamide |
|---|---|
| PubChem CID | 109452939 |
| Molecular Formula | C24H38N4O3 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.29 |
| IUPAC Name | N-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-N',2,2,3,3-pentamethylazetidine-1-carboximidamide |
| SMILES | C/N=C(\NCCCC(=O)N1CCc2cc(OC)c(OC)cc2C1)N1CC(C)(C)C1(C)C |
| InChI | InChI=1S/C24H38N4O3/c1-23(2)16-28(24(23,3)4)22(25-5)26-11-8-9-21(29)27-12-10-17-13-19(30-6)20(31-7)14-18(17)15-27/h13-14H,8-12,15-16H2,1-7H3,(H,25,26) |
| InChIKey | YSQNFBNCQVHWSO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|