C24H39IN4O3 — CID 109469867
1-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-3-[(1-ethylcyclobutyl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 109469867) has the molecular formula C24H39IN4O3 and a molecular weight of 558.51 g/mol. Its IUPAC name is 1-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-3-[(1-ethylcyclobutyl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-3-[(1-ethylcyclobutyl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109469867 |
| Molecular Formula | C24H39IN4O3 |
| Molecular Weight | 558.51 g/mol |
| Exact Mass | 558.21 |
| IUPAC Name | 1-[4-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-3-[(1-ethylcyclobutyl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | CCC1(CN/C(=N\C)NCCCC(=O)N2CCc3cc(OC)c(OC)cc3C2)CCC1.I |
| InChI | InChI=1S/C24H38N4O3.HI/c1-5-24(10-7-11-24)17-27-23(25-2)26-12-6-8-22(29)28-13-9-18-14-20(30-3)21(31-4)15-19(18)16-28;/h14-15H,5-13,16-17H2,1-4H3,(H2,25,26,27);1H |
| InChIKey | DAOYLERBLBRWNK-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.51 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|