C15H33IN4O — CID 109453357
N-[2-[2-methoxyethyl(methyl)amino]ethyl]-N',2,2,3,3-pentamethylazetidine-1-carboximidamide;hydroiodide (PubChem CID 109453357) has the molecular formula C15H33IN4O and a molecular weight of 412.36 g/mol. Its IUPAC name is N-[2-[2-methoxyethyl(methyl)amino]ethyl]-N',2,2,3,3-pentamethylazetidine-1-carboximidamide;hydroiodide.
| Compound Name | N-[2-[2-methoxyethyl(methyl)amino]ethyl]-N',2,2,3,3-pentamethylazetidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109453357 |
| Molecular Formula | C15H33IN4O |
| Molecular Weight | 412.36 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | N-[2-[2-methoxyethyl(methyl)amino]ethyl]-N',2,2,3,3-pentamethylazetidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCN(C)CCOC)N1CC(C)(C)C1(C)C.I |
| InChI | InChI=1S/C15H32N4O.HI/c1-14(2)12-19(15(14,3)4)13(16-5)17-8-9-18(6)10-11-20-7;/h8-12H2,1-7H3,(H,16,17);1H |
| InChIKey | QDIVGSQWRUIJIH-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.36 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|