C12H23N3 — CID 109453668
N-cyclopropyl-N',2,2,3,3-pentamethylazetidine-1-carboximidamide (PubChem CID 109453668) has the molecular formula C12H23N3 and a molecular weight of 209.34 g/mol. Its IUPAC name is N-cyclopropyl-N',2,2,3,3-pentamethylazetidine-1-carboximidamide.
| Compound Name | N-cyclopropyl-N',2,2,3,3-pentamethylazetidine-1-carboximidamide |
|---|---|
| PubChem CID | 109453668 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | N-cyclopropyl-N',2,2,3,3-pentamethylazetidine-1-carboximidamide |
| SMILES | C/N=C(\NC1CC1)N1CC(C)(C)C1(C)C |
| InChI | InChI=1S/C12H23N3/c1-11(2)8-15(12(11,3)4)10(13-5)14-9-6-7-9/h9H,6-8H2,1-5H3,(H,13,14) |
| InChIKey | TZHFTNWPENWMTQ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|