C17H32N4O — CID 109454236
N-cyclohexyl-2-[[N-methyl-C-(2,2,3,3-tetramethylazetidin-1-yl)carbonimidoyl]amino]acetamide (PubChem CID 109454236) has the molecular formula C17H32N4O and a molecular weight of 308.47 g/mol. Its IUPAC name is N-cyclohexyl-2-[[N-methyl-C-(2,2,3,3-tetramethylazetidin-1-yl)carbonimidoyl]amino]acetamide.
| Compound Name | N-cyclohexyl-2-[[N-methyl-C-(2,2,3,3-tetramethylazetidin-1-yl)carbonimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 109454236 |
| Molecular Formula | C17H32N4O |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.26 |
| IUPAC Name | N-cyclohexyl-2-[[N-methyl-C-(2,2,3,3-tetramethylazetidin-1-yl)carbonimidoyl]amino]acetamide |
| SMILES | C/N=C(\NCC(=O)NC1CCCCC1)N1CC(C)(C)C1(C)C |
| InChI | InChI=1S/C17H32N4O/c1-16(2)12-21(17(16,3)4)15(18-5)19-11-14(22)20-13-9-7-6-8-10-13/h13H,6-12H2,1-5H3,(H,18,19)(H,20,22) |
| InChIKey | GVDQOVQKIKJJFG-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|