C16H28IN3S — CID 109454149
N',2,2,3,3-pentamethyl-N-(2-thiophen-3-ylpropyl)azetidine-1-carboximidamide;hydroiodide (PubChem CID 109454149) has the molecular formula C16H28IN3S and a molecular weight of 421.39 g/mol. Its IUPAC name is N',2,2,3,3-pentamethyl-N-(2-thiophen-3-ylpropyl)azetidine-1-carboximidamide;hydroiodide.
| Compound Name | N',2,2,3,3-pentamethyl-N-(2-thiophen-3-ylpropyl)azetidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109454149 |
| Molecular Formula | C16H28IN3S |
| Molecular Weight | 421.39 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | N',2,2,3,3-pentamethyl-N-(2-thiophen-3-ylpropyl)azetidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCC(C)c1ccsc1)N1CC(C)(C)C1(C)C.I |
| InChI | InChI=1S/C16H27N3S.HI/c1-12(13-7-8-20-10-13)9-18-14(17-6)19-11-15(2,3)16(19,4)5;/h7-8,10,12H,9,11H2,1-6H3,(H,17,18);1H |
| InChIKey | WXFYIPZSHHKZHC-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.39 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|