C19H40IN5 — CID 109453901
N-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]-N',2,2,3,3-pentamethylazetidine-1-carboximidamide;hydroiodide (PubChem CID 109453901) has the molecular formula C19H40IN5 and a molecular weight of 465.47 g/mol. Its IUPAC name is N-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]-N',2,2,3,3-pentamethylazetidine-1-carboximidamide;hydroiodide.
| Compound Name | N-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]-N',2,2,3,3-pentamethylazetidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109453901 |
| Molecular Formula | C19H40IN5 |
| Molecular Weight | 465.47 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | N-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]-N',2,2,3,3-pentamethylazetidine-1-carboximidamide;hydroiodide |
| SMILES | CCN1CCN(CC(C)CN/C(=N\C)N2CC(C)(C)C2(C)C)CC1.I |
| InChI | InChI=1S/C19H39N5.HI/c1-8-22-9-11-23(12-10-22)14-16(2)13-21-17(20-7)24-15-18(3,4)19(24,5)6;/h16H,8-15H2,1-7H3,(H,20,21);1H |
| InChIKey | OSDNDYVTGNAQGK-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 34.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.47 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|