C18H37N5 — CID 109451945
N-[2-(4-ethylpiperazin-1-yl)propyl]-N',2,2,3,3-pentamethylazetidine-1-carboximidamide (PubChem CID 109451945) has the molecular formula C18H37N5 and a molecular weight of 323.53 g/mol. Its IUPAC name is N-[2-(4-ethylpiperazin-1-yl)propyl]-N',2,2,3,3-pentamethylazetidine-1-carboximidamide.
| Compound Name | N-[2-(4-ethylpiperazin-1-yl)propyl]-N',2,2,3,3-pentamethylazetidine-1-carboximidamide |
|---|---|
| PubChem CID | 109451945 |
| Molecular Formula | C18H37N5 |
| Molecular Weight | 323.53 g/mol |
| Exact Mass | 323.30 |
| IUPAC Name | N-[2-(4-ethylpiperazin-1-yl)propyl]-N',2,2,3,3-pentamethylazetidine-1-carboximidamide |
| SMILES | CCN1CCN(C(C)CN/C(=N\C)N2CC(C)(C)C2(C)C)CC1 |
| InChI | InChI=1S/C18H37N5/c1-8-21-9-11-22(12-10-21)15(2)13-20-16(19-7)23-14-17(3,4)18(23,5)6/h15H,8-14H2,1-7H3,(H,19,20) |
| InChIKey | ARGAAZFRGZRIBS-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 34.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.53 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|