C18H35IN4 — CID 109454339
N'-[(1-cyclopropylpyrrolidin-3-yl)methyl]-N-ethyl-2,2,3,3-tetramethylazetidine-1-carboximidamide;hydroiodide (PubChem CID 109454339) has the molecular formula C18H35IN4 and a molecular weight of 434.41 g/mol. Its IUPAC name is N'-[(1-cyclopropylpyrrolidin-3-yl)methyl]-N-ethyl-2,2,3,3-tetramethylazetidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[(1-cyclopropylpyrrolidin-3-yl)methyl]-N-ethyl-2,2,3,3-tetramethylazetidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109454339 |
| Molecular Formula | C18H35IN4 |
| Molecular Weight | 434.41 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | N'-[(1-cyclopropylpyrrolidin-3-yl)methyl]-N-ethyl-2,2,3,3-tetramethylazetidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CC1CCN(C2CC2)C1)N1CC(C)(C)C1(C)C.I |
| InChI | InChI=1S/C18H34N4.HI/c1-6-19-16(22-13-17(2,3)18(22,4)5)20-11-14-9-10-21(12-14)15-7-8-15;/h14-15H,6-13H2,1-5H3,(H,19,20);1H |
| InChIKey | OLBMSXAHTBNKHU-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|