C20H30N4 — CID 110947218
N'-[(1-cyclopropylpyrrolidin-3-yl)methyl]-N-ethyl-3,4-dihydro-1H-isoquinoline-2-carboximidamide (PubChem CID 110947218) has the molecular formula C20H30N4 and a molecular weight of 326.49 g/mol. Its IUPAC name is N'-[(1-cyclopropylpyrrolidin-3-yl)methyl]-N-ethyl-3,4-dihydro-1H-isoquinoline-2-carboximidamide.
| Compound Name | N'-[(1-cyclopropylpyrrolidin-3-yl)methyl]-N-ethyl-3,4-dihydro-1H-isoquinoline-2-carboximidamide |
|---|---|
| PubChem CID | 110947218 |
| Molecular Formula | C20H30N4 |
| Molecular Weight | 326.49 g/mol |
| Exact Mass | 326.25 |
| IUPAC Name | N'-[(1-cyclopropylpyrrolidin-3-yl)methyl]-N-ethyl-3,4-dihydro-1H-isoquinoline-2-carboximidamide |
| SMILES | CCN/C(=N\CC1CCN(C2CC2)C1)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C20H30N4/c1-2-21-20(22-13-16-9-11-23(14-16)19-7-8-19)24-12-10-17-5-3-4-6-18(17)15-24/h3-6,16,19H,2,7-15H2,1H3,(H,21,22) |
| InChIKey | ZHCCLLWYTJDPCW-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.49 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|