C19H28N4O — CID 110946602
N-ethyl-N'-(2-oxo-2-piperidin-1-ylethyl)-3,4-dihydro-1H-isoquinoline-2-carboximidamide (PubChem CID 110946602) has the molecular formula C19H28N4O and a molecular weight of 328.46 g/mol. Its IUPAC name is N-ethyl-N'-(2-oxo-2-piperidin-1-ylethyl)-3,4-dihydro-1H-isoquinoline-2-carboximidamide.
| Compound Name | N-ethyl-N'-(2-oxo-2-piperidin-1-ylethyl)-3,4-dihydro-1H-isoquinoline-2-carboximidamide |
|---|---|
| PubChem CID | 110946602 |
| Molecular Formula | C19H28N4O |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.23 |
| IUPAC Name | N-ethyl-N'-(2-oxo-2-piperidin-1-ylethyl)-3,4-dihydro-1H-isoquinoline-2-carboximidamide |
| SMILES | CCN/C(=N\CC(=O)N1CCCCC1)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C19H28N4O/c1-2-20-19(21-14-18(24)22-11-6-3-7-12-22)23-13-10-16-8-4-5-9-17(16)15-23/h4-5,8-9H,2-3,6-7,10-15H2,1H3,(H,20,21) |
| InChIKey | ZQYUXZGYSLNURE-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|