C25H32N4O2 — CID 109426560
N'-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-N-ethyl-4-phenoxypiperidine-1-carboximidamide (PubChem CID 109426560) has the molecular formula C25H32N4O2 and a molecular weight of 420.56 g/mol. Its IUPAC name is N'-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-N-ethyl-4-phenoxypiperidine-1-carboximidamide.
| Compound Name | N'-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-N-ethyl-4-phenoxypiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 109426560 |
| Molecular Formula | C25H32N4O2 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | N'-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-N-ethyl-4-phenoxypiperidine-1-carboximidamide |
| SMILES | CCN/C(=N\CC(=O)N1CCc2ccccc2C1)N1CCC(Oc2ccccc2)CC1 |
| InChI | InChI=1S/C25H32N4O2/c1-2-26-25(28-16-13-23(14-17-28)31-22-10-4-3-5-11-22)27-18-24(30)29-15-12-20-8-6-7-9-21(20)19-29/h3-11,23H,2,12-19H2,1H3,(H,26,27) |
| InChIKey | VTEXMLOTDCEUPK-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|