C20H30N4O — CID 111209985
N'-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-N-ethyl-4-methylpiperidine-1-carboximidamide (PubChem CID 111209985) has the molecular formula C20H30N4O and a molecular weight of 342.49 g/mol. Its IUPAC name is N'-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-N-ethyl-4-methylpiperidine-1-carboximidamide.
| Compound Name | N'-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-N-ethyl-4-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111209985 |
| Molecular Formula | C20H30N4O |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | N'-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-N-ethyl-4-methylpiperidine-1-carboximidamide |
| SMILES | CCN/C(=N\CC(=O)N1CCc2ccccc2C1)N1CCC(C)CC1 |
| InChI | InChI=1S/C20H30N4O/c1-3-21-20(23-11-8-16(2)9-12-23)22-14-19(25)24-13-10-17-6-4-5-7-18(17)15-24/h4-7,16H,3,8-15H2,1-2H3,(H,21,22) |
| InChIKey | ZTEVPWLWOITUFA-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 47.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|