C15H28IN5O — CID 109454355
N-ethyl-2,2,3,3-tetramethyl-N'-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]azetidine-1-carboximidamide;hydroiodide (PubChem CID 109454355) has the molecular formula C15H28IN5O and a molecular weight of 421.33 g/mol. Its IUPAC name is N-ethyl-2,2,3,3-tetramethyl-N'-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]azetidine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-2,2,3,3-tetramethyl-N'-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]azetidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109454355 |
| Molecular Formula | C15H28IN5O |
| Molecular Weight | 421.33 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | N-ethyl-2,2,3,3-tetramethyl-N'-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]azetidine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCc1nc(C)no1)N1CC(C)(C)C1(C)C.I |
| InChI | InChI=1S/C15H27N5O.HI/c1-7-16-13(20-10-14(3,4)15(20,5)6)17-9-8-12-18-11(2)19-21-12;/h7-10H2,1-6H3,(H,16,17);1H |
| InChIKey | YFCWBRMTVSTQCA-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 66.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.33 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|